C14H11BrCl2N2O — CID 104589264
4-[(4-bromo-2,3-dichloroanilino)methyl]benzamide (PubChem CID 104589264) has the molecular formula C14H11BrCl2N2O and a molecular weight of 374.07 g/mol. Its IUPAC name is 4-[(4-bromo-2,3-dichloroanilino)methyl]benzamide.
| Compound Name | 4-[(4-bromo-2,3-dichloroanilino)methyl]benzamide |
|---|---|
| PubChem CID | 104589264 |
| Molecular Formula | C14H11BrCl2N2O |
| Molecular Weight | 374.07 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 4-[(4-bromo-2,3-dichloroanilino)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CNc2ccc(Br)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C14H11BrCl2N2O/c15-10-5-6-11(13(17)12(10)16)19-7-8-1-3-9(4-2-8)14(18)20/h1-6,19H,7H2,(H2,18,20) |
| InChIKey | LRUZFMMGJFJDCH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.07 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|