C13H10BrCl2N3O — CID 107787000
4-amino-3-(4-bromo-2,3-dichloroanilino)benzamide (PubChem CID 107787000) has the molecular formula C13H10BrCl2N3O and a molecular weight of 375.05 g/mol. Its IUPAC name is 4-amino-3-(4-bromo-2,3-dichloroanilino)benzamide.
| Compound Name | 4-amino-3-(4-bromo-2,3-dichloroanilino)benzamide |
|---|---|
| PubChem CID | 107787000 |
| Molecular Formula | C13H10BrCl2N3O |
| Molecular Weight | 375.05 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | 4-amino-3-(4-bromo-2,3-dichloroanilino)benzamide |
| SMILES | NC(=O)c1ccc(N)c(Nc2ccc(Br)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H10BrCl2N3O/c14-7-2-4-9(12(16)11(7)15)19-10-5-6(13(18)20)1-3-8(10)17/h1-5,19H,17H2,(H2,18,20) |
| InChIKey | OLLXHEZGTOFQEV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.05 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|