C14H11BrCl2N2O2 — CID 107792962
methyl 4-amino-3-(4-bromo-2,3-dichloroanilino)benzoate (PubChem CID 107792962) has the molecular formula C14H11BrCl2N2O2 and a molecular weight of 390.06 g/mol. Its IUPAC name is methyl 4-amino-3-(4-bromo-2,3-dichloroanilino)benzoate.
| Compound Name | methyl 4-amino-3-(4-bromo-2,3-dichloroanilino)benzoate |
|---|---|
| PubChem CID | 107792962 |
| Molecular Formula | C14H11BrCl2N2O2 |
| Molecular Weight | 390.06 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | methyl 4-amino-3-(4-bromo-2,3-dichloroanilino)benzoate |
| SMILES | COC(=O)c1ccc(N)c(Nc2ccc(Br)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H11BrCl2N2O2/c1-21-14(20)7-2-4-9(18)11(6-7)19-10-5-3-8(15)12(16)13(10)17/h2-6,19H,18H2,1H3 |
| InChIKey | PVNGJGITQCOMSH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|