C13H11Cl2N3O — CID 65468318
4-amino-3-(2,6-dichloroanilino)benzamide (PubChem CID 65468318) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is 4-amino-3-(2,6-dichloroanilino)benzamide.
| Compound Name | 4-amino-3-(2,6-dichloroanilino)benzamide |
|---|---|
| PubChem CID | 65468318 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-amino-3-(2,6-dichloroanilino)benzamide |
| SMILES | NC(=O)c1ccc(N)c(Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C13H11Cl2N3O/c14-8-2-1-3-9(15)12(8)18-11-6-7(13(17)19)4-5-10(11)16/h1-6,18H,16H2,(H2,17,19) |
| InChIKey | NTUNEHIWUGRMPI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|