C10H7BrCl2N2S — CID 107787698
4-bromo-2,3-dichloro-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 107787698) has the molecular formula C10H7BrCl2N2S and a molecular weight of 338.06 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 107787698 |
| Molecular Formula | C10H7BrCl2N2S |
| Molecular Weight | 338.06 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | Clc1c(Br)ccc(NCc2cncs2)c1Cl |
| InChI | InChI=1S/C10H7BrCl2N2S/c11-7-1-2-8(10(13)9(7)12)15-4-6-3-14-5-16-6/h1-3,5,15H,4H2 |
| InChIKey | FRUQAGORVBZCQL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.06 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|