C12H7BrCl2N2S — CID 107787716
5-[(4-bromo-2,3-dichloroanilino)methyl]thiophene-3-carbonitrile (PubChem CID 107787716) has the molecular formula C12H7BrCl2N2S and a molecular weight of 362.08 g/mol. Its IUPAC name is 5-[(4-bromo-2,3-dichloroanilino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(4-bromo-2,3-dichloroanilino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 107787716 |
| Molecular Formula | C12H7BrCl2N2S |
| Molecular Weight | 362.08 g/mol |
| Exact Mass | 359.89 |
| IUPAC Name | 5-[(4-bromo-2,3-dichloroanilino)methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2ccc(Br)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C12H7BrCl2N2S/c13-9-1-2-10(12(15)11(9)14)17-5-8-3-7(4-16)6-18-8/h1-3,6,17H,5H2 |
| InChIKey | NPLDTIYMDIUCPV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.08 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|