C12H7Cl3N2S — CID 79606257
5-[(2,4,5-trichloroanilino)methyl]thiophene-3-carbonitrile (PubChem CID 79606257) has the molecular formula C12H7Cl3N2S and a molecular weight of 317.63 g/mol. Its IUPAC name is 5-[(2,4,5-trichloroanilino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(2,4,5-trichloroanilino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79606257 |
| Molecular Formula | C12H7Cl3N2S |
| Molecular Weight | 317.63 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 5-[(2,4,5-trichloroanilino)methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C12H7Cl3N2S/c13-9-2-11(15)12(3-10(9)14)17-5-8-1-7(4-16)6-18-8/h1-3,6,17H,5H2 |
| InChIKey | WTKWWQNOHUHIBT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|