C13H10ClN3OS — CID 79613768
2-chloro-4-[(4-cyanothiophen-2-yl)methylamino]benzamide (PubChem CID 79613768) has the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-chloro-4-[(4-cyanothiophen-2-yl)methylamino]benzamide.
| Compound Name | 2-chloro-4-[(4-cyanothiophen-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 79613768 |
| Molecular Formula | C13H10ClN3OS |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-chloro-4-[(4-cyanothiophen-2-yl)methylamino]benzamide |
| SMILES | N#Cc1csc(CNc2ccc(C(N)=O)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H10ClN3OS/c14-12-4-9(1-2-11(12)13(16)18)17-6-10-3-8(5-15)7-19-10/h1-4,7,17H,6H2,(H2,16,18) |
| InChIKey | MOZJQTDBZLMZHS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |