About 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile
5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile (PubChem CID 79605817) has the molecular formula C12H8Cl2N2S
and a molecular weight of 283.18 g/mol. Its IUPAC name is 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile |
| PubChem CID | 79605817 |
| Molecular Formula | C12H8Cl2N2S |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C12H8Cl2N2S/c13-9-2-10(14)4-11(3-9)16-6-12-1-8(5-15)7-17-12/h1-4,7,16H,6H2 |
| InChIKey | WIKNYQISAFDSIK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile?
The IUPAC name of 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile (CID 79605817) is 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile.
What is the SMILES notation for 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile?
The canonical SMILES for 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile is N#Cc1csc(CNc2cc(Cl)cc(Cl)c2)c1.
What is the InChIKey of 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile?
The InChIKey is WIKNYQISAFDSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2S/c13-9-2-10(14)4-11(3-9)16-6-12-1-8(5-15)7-17-12/h1-4,7,16H,6H2.
What are the key properties of 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile?
5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile has a molecular weight of 283.18 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dichloroanilino)methyl]thiophene-3-carbonitrile is sourced from PubChem (CID 79605817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).