C12H5F5N2S — CID 115564177
5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carbonitrile (PubChem CID 115564177) has the molecular formula C12H5F5N2S and a molecular weight of 304.24 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 115564177 |
| Molecular Formula | C12H5F5N2S |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C12H5F5N2S/c13-7-8(14)10(16)12(11(17)9(7)15)19-3-6-1-5(2-18)4-20-6/h1,4,19H,3H2 |
| InChIKey | HQGIWHPDGNNFIS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|