C12H8Cl2N2S — CID 79614072
5-[(2,3-dichloroanilino)methyl]thiophene-3-carbonitrile (PubChem CID 79614072) has the molecular formula C12H8Cl2N2S and a molecular weight of 283.18 g/mol. Its IUPAC name is 5-[(2,3-dichloroanilino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(2,3-dichloroanilino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79614072 |
| Molecular Formula | C12H8Cl2N2S |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 5-[(2,3-dichloroanilino)methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N2S/c13-10-2-1-3-11(12(10)14)16-6-9-4-8(5-15)7-17-9/h1-4,7,16H,6H2 |
| InChIKey | YYFTWCYKYSDXMQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |