C12H10BrN3O2S2 — CID 79614192
3-bromo-4-[(4-cyanothiophen-2-yl)methylamino]benzenesulfonamide (PubChem CID 79614192) has the molecular formula C12H10BrN3O2S2 and a molecular weight of 372.27 g/mol. Its IUPAC name is 3-bromo-4-[(4-cyanothiophen-2-yl)methylamino]benzenesulfonamide.
| Compound Name | 3-bromo-4-[(4-cyanothiophen-2-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 79614192 |
| Molecular Formula | C12H10BrN3O2S2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 3-bromo-4-[(4-cyanothiophen-2-yl)methylamino]benzenesulfonamide |
| SMILES | N#Cc1csc(CNc2ccc(S(N)(=O)=O)cc2Br)c1 |
| InChI | InChI=1S/C12H10BrN3O2S2/c13-11-4-10(20(15,17)18)1-2-12(11)16-6-9-3-8(5-14)7-19-9/h1-4,7,16H,6H2,(H2,15,17,18) |
| InChIKey | HJADLRATUZEKLU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |