C13H11FN2O2S2 — CID 79613842
5-[(2-fluoro-5-methylsulfonylanilino)methyl]thiophene-3-carbonitrile (PubChem CID 79613842) has the molecular formula C13H11FN2O2S2 and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-[(2-fluoro-5-methylsulfonylanilino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(2-fluoro-5-methylsulfonylanilino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79613842 |
| Molecular Formula | C13H11FN2O2S2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 5-[(2-fluoro-5-methylsulfonylanilino)methyl]thiophene-3-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc(F)c(NCc2cc(C#N)cs2)c1 |
| InChI | InChI=1S/C13H11FN2O2S2/c1-20(17,18)11-2-3-12(14)13(5-11)16-7-10-4-9(6-15)8-19-10/h2-5,8,16H,7H2,1H3 |
| InChIKey | UVLIOYOJCHBGBH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |