C10H10BrN3O2S2 — CID 55248530
3-bromo-4-(1,3-thiazol-2-ylmethylamino)benzenesulfonamide (PubChem CID 55248530) has the molecular formula C10H10BrN3O2S2 and a molecular weight of 348.25 g/mol. Its IUPAC name is 3-bromo-4-(1,3-thiazol-2-ylmethylamino)benzenesulfonamide.
| Compound Name | 3-bromo-4-(1,3-thiazol-2-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 55248530 |
| Molecular Formula | C10H10BrN3O2S2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 3-bromo-4-(1,3-thiazol-2-ylmethylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCc2nccs2)c(Br)c1 |
| InChI | InChI=1S/C10H10BrN3O2S2/c11-8-5-7(18(12,15)16)1-2-9(8)14-6-10-13-3-4-17-10/h1-5,14H,6H2,(H2,12,15,16) |
| InChIKey | KILQXWPXEUMLQG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |