C12H12Br2N2O2S2 — CID 43790989
3-bromo-4-[1-(3-bromothiophen-2-yl)ethylamino]benzenesulfonamide (PubChem CID 43790989) has the molecular formula C12H12Br2N2O2S2 and a molecular weight of 440.18 g/mol. Its IUPAC name is 3-bromo-4-[1-(3-bromothiophen-2-yl)ethylamino]benzenesulfonamide.
| Compound Name | 3-bromo-4-[1-(3-bromothiophen-2-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 43790989 |
| Molecular Formula | C12H12Br2N2O2S2 |
| Molecular Weight | 440.18 g/mol |
| Exact Mass | 437.87 |
| IUPAC Name | 3-bromo-4-[1-(3-bromothiophen-2-yl)ethylamino]benzenesulfonamide |
| SMILES | CC(Nc1ccc(S(N)(=O)=O)cc1Br)c1sccc1Br |
| InChI | InChI=1S/C12H12Br2N2O2S2/c1-7(12-9(13)4-5-19-12)16-11-3-2-8(6-10(11)14)20(15,17)18/h2-7,16H,1H3,(H2,15,17,18) |
| InChIKey | POQPKKUPBUGGIC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |