C12H12BrN3O3S — CID 79783627
3-bromo-4-[(5-hydroxy-2-pyridinyl)methylamino]benzenesulfonamide (PubChem CID 79783627) has the molecular formula C12H12BrN3O3S and a molecular weight of 358.22 g/mol. Its IUPAC name is 3-bromo-4-[(5-hydroxy-2-pyridinyl)methylamino]benzenesulfonamide.
| Compound Name | 3-bromo-4-[(5-hydroxy-2-pyridinyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 79783627 |
| Molecular Formula | C12H12BrN3O3S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 3-bromo-4-[(5-hydroxy-2-pyridinyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCc2ccc(O)cn2)c(Br)c1 |
| InChI | InChI=1S/C12H12BrN3O3S/c13-11-5-10(20(14,18)19)3-4-12(11)16-6-8-1-2-9(17)7-15-8/h1-5,7,16-17H,6H2,(H2,14,18,19) |
| InChIKey | ZAMODXRHWRQUTN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |