C12H9F3N2O — CID 79775562
6-[(2,3,4-trifluoroanilino)methyl]pyridin-3-ol (PubChem CID 79775562) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is 6-[(2,3,4-trifluoroanilino)methyl]pyridin-3-ol.
| Compound Name | 6-[(2,3,4-trifluoroanilino)methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 79775562 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 6-[(2,3,4-trifluoroanilino)methyl]pyridin-3-ol |
| SMILES | Oc1ccc(CNc2ccc(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C12H9F3N2O/c13-9-3-4-10(12(15)11(9)14)17-5-7-1-2-8(18)6-16-7/h1-4,6,17-18H,5H2 |
| InChIKey | FLUGXVXBXCUKRK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|