C14H16N2O3 — CID 79775559
6-[(2,4-dimethoxyanilino)methyl]pyridin-3-ol (PubChem CID 79775559) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 6-[(2,4-dimethoxyanilino)methyl]pyridin-3-ol.
| Compound Name | 6-[(2,4-dimethoxyanilino)methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 79775559 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 6-[(2,4-dimethoxyanilino)methyl]pyridin-3-ol |
| SMILES | COc1ccc(NCc2ccc(O)cn2)c(OC)c1 |
| InChI | InChI=1S/C14H16N2O3/c1-18-12-5-6-13(14(7-12)19-2)16-8-10-3-4-11(17)9-15-10/h3-7,9,16-17H,8H2,1-2H3 |
| InChIKey | KKQMBBHTXPJJGX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|