C15H16N2O4 — CID 106904347
6-[(2,4-dimethoxyanilino)methyl]pyridine-2-carboxylic acid (PubChem CID 106904347) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-[(2,4-dimethoxyanilino)methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2,4-dimethoxyanilino)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106904347 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 6-[(2,4-dimethoxyanilino)methyl]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(NCc2cccc(C(=O)O)n2)c(OC)c1 |
| InChI | InChI=1S/C15H16N2O4/c1-20-11-6-7-12(14(8-11)21-2)16-9-10-4-3-5-13(17-10)15(18)19/h3-8,16H,9H2,1-2H3,(H,18,19) |
| InChIKey | YLBMZQVXHWBBDY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|