6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid

C13H10Br2N2O2 — CID 106904620

IUPAC6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(CNc2ccc(Br)cc2Br)n1
InChIInChI=1S/C13H10Br2N2O2/c14-8-4-5-11(10(15)6-8)16-7-9-2-1-3-12(17-9)13(18)19/h1-6,16H,7H2,(H,18,19)
InChIKeyOXPHSYFGFBXVRQ-UHFFFAOYSA-N
MW386.04 g/mol
LogP3.92
Rot. Bonds4

About 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid

6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid (PubChem CID 106904620) has the molecular formula C13H10Br2N2O2 and a molecular weight of 386.04 g/mol. Its IUPAC name is 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid
PubChem CID106904620
Molecular FormulaC13H10Br2N2O2
Molecular Weight386.04 g/mol
Exact Mass383.91
IUPAC Name6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(CNc2ccc(Br)cc2Br)n1
InChIInChI=1S/C13H10Br2N2O2/c14-8-4-5-11(10(15)6-8)16-7-9-2-1-3-12(17-9)13(18)19/h1-6,16H,7H2,(H,18,19)
InChIKeyOXPHSYFGFBXVRQ-UHFFFAOYSA-N
XLogP3.92
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500386.04
LogP ≤ 53.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid (CID 106904620) is 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid is O=C(O)c1cccc(CNc2ccc(Br)cc2Br)n1.
What is the InChIKey of 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid?
The InChIKey is OXPHSYFGFBXVRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Br2N2O2/c14-8-4-5-11(10(15)6-8)16-7-9-2-1-3-12(17-9)13(18)19/h1-6,16H,7H2,(H,18,19).
What are the key properties of 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid?
6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid has a molecular weight of 386.04 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,4-dibromoanilino)methyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 106904620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).