C14H12BrFN2O2 — CID 106904521
6-[[(2-bromo-5-fluorophenyl)methylamino]methyl]pyridine-2-carboxylic acid (PubChem CID 106904521) has the molecular formula C14H12BrFN2O2 and a molecular weight of 339.16 g/mol. Its IUPAC name is 6-[[(2-bromo-5-fluorophenyl)methylamino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[(2-bromo-5-fluorophenyl)methylamino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106904521 |
| Molecular Formula | C14H12BrFN2O2 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 6-[[(2-bromo-5-fluorophenyl)methylamino]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CNCc2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C14H12BrFN2O2/c15-12-5-4-10(16)6-9(12)7-17-8-11-2-1-3-13(18-11)14(19)20/h1-6,17H,7-8H2,(H,19,20) |
| InChIKey | CJUJOKFBJWZBNS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |