C15H10N2O5 — CID 156761601
6-[[(1,3-dioxo-2-benzofuran-4-yl)amino]methyl]pyridine-2-carboxylic acid (PubChem CID 156761601) has the molecular formula C15H10N2O5 and a molecular weight of 298.25 g/mol. Its IUPAC name is 6-[[(1,3-dioxo-2-benzofuran-4-yl)amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[(1,3-dioxo-2-benzofuran-4-yl)amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 156761601 |
| Molecular Formula | C15H10N2O5 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-[[(1,3-dioxo-2-benzofuran-4-yl)amino]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CNc2cccc3c2C(=O)OC3=O)n1 |
| InChI | InChI=1S/C15H10N2O5/c18-13(19)11-6-1-3-8(17-11)7-16-10-5-2-4-9-12(10)15(21)22-14(9)20/h1-6,16H,7H2,(H,18,19) |
| InChIKey | HUSIZFJWPCBBDE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|