6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid

C14H14N2O4 — CID 62254625

IUPAC6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid
SMILESCOc1ccc(OC)c(Nc2cccc(C(=O)O)n2)c1
InChIInChI=1S/C14H14N2O4/c1-19-9-6-7-12(20-2)11(8-9)16-13-5-3-4-10(15-13)14(17)18/h3-8H,1-2H3,(H,15,16)(H,17,18)
InChIKeyILBPLPSYWMITRT-UHFFFAOYSA-N
MW274.28 g/mol
LogP2.54
Rot. Bonds5

About 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid

6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid (PubChem CID 62254625) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid
PubChem CID62254625
Molecular FormulaC14H14N2O4
Molecular Weight274.28 g/mol
Exact Mass274.10
IUPAC Name6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid
SMILESCOc1ccc(OC)c(Nc2cccc(C(=O)O)n2)c1
InChIInChI=1S/C14H14N2O4/c1-19-9-6-7-12(20-2)11(8-9)16-13-5-3-4-10(15-13)14(17)18/h3-8H,1-2H3,(H,15,16)(H,17,18)
InChIKeyILBPLPSYWMITRT-UHFFFAOYSA-N
XLogP2.54
TPSA80.68 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.28
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid?
The IUPAC name of 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid (CID 62254625) is 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid is COc1ccc(OC)c(Nc2cccc(C(=O)O)n2)c1.
What is the InChIKey of 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid?
The InChIKey is ILBPLPSYWMITRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4/c1-19-9-6-7-12(20-2)11(8-9)16-13-5-3-4-10(15-13)14(17)18/h3-8H,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid?
6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid has a molecular weight of 274.28 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethoxyanilino)pyridine-2-carboxylic acid is sourced from PubChem (CID 62254625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).