C26H26N6O6 — CID 1270210
4-[[4,6-bis(2,5-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 1270210) has the molecular formula C26H26N6O6 and a molecular weight of 518.53 g/mol. Its IUPAC name is 4-[[4,6-bis(2,5-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4,6-bis(2,5-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 1270210 |
| Molecular Formula | C26H26N6O6 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 4-[[4,6-bis(2,5-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | COc1ccc(OC)c(Nc2nc(Nc3ccc(C(=O)O)cc3)nc(Nc3cc(OC)ccc3OC)n2)c1 |
| InChI | InChI=1S/C26H26N6O6/c1-35-17-9-11-21(37-3)19(13-17)28-25-30-24(27-16-7-5-15(6-8-16)23(33)34)31-26(32-25)29-20-14-18(36-2)10-12-22(20)38-4/h5-14H,1-4H3,(H,33,34)(H3,27,28,29,30,31,32) |
| InChIKey | LJUDVBFWJGAKFZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 148.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |