C14H13ClN2O4 — CID 43166932
2-chloro-6-(2,5-dimethoxyanilino)pyridine-4-carboxylic acid (PubChem CID 43166932) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 2-chloro-6-(2,5-dimethoxyanilino)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(2,5-dimethoxyanilino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43166932 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-chloro-6-(2,5-dimethoxyanilino)pyridine-4-carboxylic acid |
| SMILES | COc1ccc(OC)c(Nc2cc(C(=O)O)cc(Cl)n2)c1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-20-9-3-4-11(21-2)10(7-9)16-13-6-8(14(18)19)5-12(15)17-13/h3-7H,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | IWDXWYNLYJPOAU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|