C11H13N3O2S — CID 43663822
2,4-dimethoxy-N-(thiadiazol-4-ylmethyl)aniline (PubChem CID 43663822) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(thiadiazol-4-ylmethyl)aniline.
| Compound Name | 2,4-dimethoxy-N-(thiadiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 43663822 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2,4-dimethoxy-N-(thiadiazol-4-ylmethyl)aniline |
| SMILES | COc1ccc(NCc2csnn2)c(OC)c1 |
| InChI | InChI=1S/C11H13N3O2S/c1-15-9-3-4-10(11(5-9)16-2)12-6-8-7-17-14-13-8/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | ZPDKGJVMOVRFNE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|