C10H11N3O3S2 — CID 61285408
3-amino-4-hydroxy-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide (PubChem CID 61285408) has the molecular formula C10H11N3O3S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-4-hydroxy-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61285408 |
| Molecular Formula | C10H11N3O3S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 3-amino-4-hydroxy-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCc2nccs2)ccc1O |
| InChI | InChI=1S/C10H11N3O3S2/c11-8-5-7(1-2-9(8)14)18(15,16)13-6-10-12-3-4-17-10/h1-5,13-14H,6,11H2 |
| InChIKey | ODPXYTPRMROHQD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|