C10H9BrFN3S — CID 116736330
4-bromo-5-fluoro-2-N-(1,3-thiazol-5-ylmethyl)benzene-1,2-diamine (PubChem CID 116736330) has the molecular formula C10H9BrFN3S and a molecular weight of 302.17 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-N-(1,3-thiazol-5-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-2-N-(1,3-thiazol-5-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 116736330 |
| Molecular Formula | C10H9BrFN3S |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 4-bromo-5-fluoro-2-N-(1,3-thiazol-5-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(F)c(Br)cc1NCc1cncs1 |
| InChI | InChI=1S/C10H9BrFN3S/c11-7-1-10(9(13)2-8(7)12)15-4-6-3-14-5-16-6/h1-3,5,15H,4,13H2 |
| InChIKey | KBDNJMPTGSLSCH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|