C10H10BrFN4 — CID 116736060
4-bromo-5-fluoro-2-N-(1H-imidazol-5-ylmethyl)benzene-1,2-diamine (PubChem CID 116736060) has the molecular formula C10H10BrFN4 and a molecular weight of 285.12 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-N-(1H-imidazol-5-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-2-N-(1H-imidazol-5-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 116736060 |
| Molecular Formula | C10H10BrFN4 |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 4-bromo-5-fluoro-2-N-(1H-imidazol-5-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(F)c(Br)cc1NCc1cnc[nH]1 |
| InChI | InChI=1S/C10H10BrFN4/c11-7-1-10(9(13)2-8(7)12)15-4-6-3-14-5-16-6/h1-3,5,15H,4,13H2,(H,14,16) |
| InChIKey | OZKHRFXOOAHOMN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|