C11H8BrF2NS — CID 102852659
5-bromo-2,4-difluoro-N-(thiophen-2-ylmethyl)aniline (PubChem CID 102852659) has the molecular formula C11H8BrF2NS and a molecular weight of 304.16 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 5-bromo-2,4-difluoro-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 102852659 |
| Molecular Formula | C11H8BrF2NS |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-(thiophen-2-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(NCc2cccs2)cc1Br |
| InChI | InChI=1S/C11H8BrF2NS/c12-8-4-11(10(14)5-9(8)13)15-6-7-2-1-3-16-7/h1-5,15H,6H2 |
| InChIKey | NMMZUMSYBYTUCJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|