C11H11FN2S — CID 60788587
3-fluoro-1-N-(thiophen-2-ylmethyl)benzene-1,2-diamine (PubChem CID 60788587) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-fluoro-1-N-(thiophen-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-(thiophen-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 60788587 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-fluoro-1-N-(thiophen-2-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1c(F)cccc1NCc1cccs1 |
| InChI | InChI=1S/C11H11FN2S/c12-9-4-1-5-10(11(9)13)14-7-8-3-2-6-15-8/h1-6,14H,7,13H2 |
| InChIKey | HGNLHVREJPEZJI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|