C12H8BrF2NO2S — CID 103268902
5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carboxylic acid (PubChem CID 103268902) has the molecular formula C12H8BrF2NO2S and a molecular weight of 348.17 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103268902 |
| Molecular Formula | C12H8BrF2NO2S |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 5-[(5-bromo-2,4-difluoroanilino)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2cc(Br)c(F)cc2F)s1 |
| InChI | InChI=1S/C12H8BrF2NO2S/c13-7-3-10(9(15)4-8(7)14)16-5-6-1-2-11(19-6)12(17)18/h1-4,16H,5H2,(H,17,18) |
| InChIKey | ZNNLKMONKIOSHC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|