C13H9F4NO2S — CID 103243138
5-[[4-fluoro-3-(trifluoromethyl)anilino]methyl]thiophene-2-carboxylic acid (PubChem CID 103243138) has the molecular formula C13H9F4NO2S and a molecular weight of 319.28 g/mol. Its IUPAC name is 5-[[4-fluoro-3-(trifluoromethyl)anilino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[4-fluoro-3-(trifluoromethyl)anilino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103243138 |
| Molecular Formula | C13H9F4NO2S |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 5-[[4-fluoro-3-(trifluoromethyl)anilino]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2ccc(F)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C13H9F4NO2S/c14-10-3-1-7(5-9(10)13(15,16)17)18-6-8-2-4-11(21-8)12(19)20/h1-5,18H,6H2,(H,19,20) |
| InChIKey | UNBYMJHKWSDYDR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |