C15H15NO4S — CID 103232399
5-[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103232399) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103232399 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2ccc3c(c2)OCCCO3)s1 |
| InChI | InChI=1S/C15H15NO4S/c17-15(18)14-5-3-11(21-14)9-16-10-2-4-12-13(8-10)20-7-1-6-19-12/h2-5,8,16H,1,6-7,9H2,(H,17,18) |
| InChIKey | IFDZISMZKHGNFN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|