C15H15NO5 — CID 103233832
5-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3-methylfuran-2-carboxylic acid (PubChem CID 103233832) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3-methylfuran-2-carboxylic acid.
| Compound Name | 5-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103233832 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)methyl]-3-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(CNc2ccc3c(c2)OCCO3)oc1C(=O)O |
| InChI | InChI=1S/C15H15NO5/c1-9-6-11(21-14(9)15(17)18)8-16-10-2-3-12-13(7-10)20-5-4-19-12/h2-3,6-7,16H,4-5,8H2,1H3,(H,17,18) |
| InChIKey | LINZQIAMVONCEA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|