C13H18N2O3 — CID 62324572
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-methylpropanamide (PubChem CID 62324572) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-methylpropanamide.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-methylpropanamide |
|---|---|
| PubChem CID | 62324572 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H18N2O3/c1-14-13(16)5-6-15-10-3-4-11-12(9-10)18-8-2-7-17-11/h3-4,9,15H,2,5-8H2,1H3,(H,14,16) |
| InChIKey | MJEYDIKRHATPOW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|