C16H22N2O4 — CID 109015955
3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 109015955) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 109015955 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | O=C(CCNc1ccc2c(c1)OCCO2)NCC1CCCO1 |
| InChI | InChI=1S/C16H22N2O4/c19-16(18-11-13-2-1-7-20-13)5-6-17-12-3-4-14-15(10-12)22-9-8-21-14/h3-4,10,13,17H,1-2,5-9,11H2,(H,18,19) |
| InChIKey | NVUOLBJKKGCKOZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|