C15H18ClF3N2O2 — CID 109015962
3-[4-chloro-3-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 109015962) has the molecular formula C15H18ClF3N2O2 and a molecular weight of 350.77 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 109015962 |
| Molecular Formula | C15H18ClF3N2O2 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | O=C(CCNc1ccc(Cl)c(C(F)(F)F)c1)NCC1CCCO1 |
| InChI | InChI=1S/C15H18ClF3N2O2/c16-13-4-3-10(8-12(13)15(17,18)19)20-6-5-14(22)21-9-11-2-1-7-23-11/h3-4,8,11,20H,1-2,5-7,9H2,(H,21,22) |
| InChIKey | ZVKWQYGSYKSSTL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |