C14H18ClF3N2O — CID 109012712
3-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methylpropyl)propanamide (PubChem CID 109012712) has the molecular formula C14H18ClF3N2O and a molecular weight of 322.76 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methylpropyl)propanamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 109012712 |
| Molecular Formula | C14H18ClF3N2O |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)CCNc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3N2O/c1-9(2)8-20-13(21)5-6-19-10-3-4-12(15)11(7-10)14(16,17)18/h3-4,7,9,19H,5-6,8H2,1-2H3,(H,20,21) |
| InChIKey | BDZRPDPGPQKZOY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |