C16H20ClF3N2O — CID 109014086
3-[4-chloro-3-(trifluoromethyl)anilino]-N-cyclohexylpropanamide (PubChem CID 109014086) has the molecular formula C16H20ClF3N2O and a molecular weight of 348.80 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)anilino]-N-cyclohexylpropanamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 109014086 |
| Molecular Formula | C16H20ClF3N2O |
| Molecular Weight | 348.80 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)anilino]-N-cyclohexylpropanamide |
| SMILES | O=C(CCNc1ccc(Cl)c(C(F)(F)F)c1)NC1CCCCC1 |
| InChI | InChI=1S/C16H20ClF3N2O/c17-14-7-6-12(10-13(14)16(18,19)20)21-9-8-15(23)22-11-4-2-1-3-5-11/h6-7,10-11,21H,1-5,8-9H2,(H,22,23) |
| InChIKey | IWMIIEVHZYCTDT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.80 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |