C13H17NO4 — CID 43377888
methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)butanoate (PubChem CID 43377888) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)butanoate.
| Compound Name | methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)butanoate |
|---|---|
| PubChem CID | 43377888 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)butanoate |
| SMILES | COC(=O)CCCNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H17NO4/c1-16-13(15)3-2-6-14-10-4-5-11-12(9-10)18-8-7-17-11/h4-5,9,14H,2-3,6-8H2,1H3 |
| InChIKey | DRFBRKCHSYYDTF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|