C18H29NO2 — CID 63487624
N-decyl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 63487624) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-decyl-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-decyl-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 63487624 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-decyl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CCCCCCCCCCNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H29NO2/c1-2-3-4-5-6-7-8-9-12-19-16-10-11-17-18(15-16)21-14-13-20-17/h10-11,15,19H,2-9,12-14H2,1H3 |
| InChIKey | LISYISGAAWNZTG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|