C13H15NO2 — CID 104744129
N-pent-3-ynyl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 104744129) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is N-pent-3-ynyl-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-pent-3-ynyl-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 104744129 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-pent-3-ynyl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC#CCCNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H15NO2/c1-2-3-4-7-14-11-5-6-12-13(10-11)16-9-8-15-12/h5-6,10,14H,4,7-9H2,1H3 |
| InChIKey | RKQINQZCPXNEJH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|