C13H18N2 — CID 104807429
3-N,3-N-dimethyl-1-N-pent-3-ynylbenzene-1,3-diamine (PubChem CID 104807429) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-1-N-pent-3-ynylbenzene-1,3-diamine.
| Compound Name | 3-N,3-N-dimethyl-1-N-pent-3-ynylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 104807429 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-N,3-N-dimethyl-1-N-pent-3-ynylbenzene-1,3-diamine |
| SMILES | CC#CCCNc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C13H18N2/c1-4-5-6-10-14-12-8-7-9-13(11-12)15(2)3/h7-9,11,14H,6,10H2,1-3H3 |
| InChIKey | MHCOIAKRDUUGKC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|