C12H18N2 — CID 107899162
1-N-[(E)-but-2-enyl]-3-N,3-N-dimethylbenzene-1,3-diamine (PubChem CID 107899162) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-N-[(E)-but-2-enyl]-3-N,3-N-dimethylbenzene-1,3-diamine.
| Compound Name | 1-N-[(E)-but-2-enyl]-3-N,3-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 107899162 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-N-[(E)-but-2-enyl]-3-N,3-N-dimethylbenzene-1,3-diamine |
| SMILES | C/C=C/CNc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C12H18N2/c1-4-5-9-13-11-7-6-8-12(10-11)14(2)3/h4-8,10,13H,9H2,1-3H3/b5-4+ |
| InChIKey | MQRICFQJNCOWHC-SNAWJCMRSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|