C12H17NO2 — CID 15482224
N-butyl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 15482224) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-butyl-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-butyl-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 15482224 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-butyl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CCCCNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H17NO2/c1-2-3-6-13-10-4-5-11-12(9-10)15-8-7-14-11/h4-5,9,13H,2-3,6-8H2,1H3 |
| InChIKey | MVNCRVVUZXEALF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|