C12H7Br2F2NO2S — CID 102833620
5-[(4,5-dibromothiophen-2-yl)methylamino]-2,4-difluorobenzoic acid (PubChem CID 102833620) has the molecular formula C12H7Br2F2NO2S and a molecular weight of 427.06 g/mol. Its IUPAC name is 5-[(4,5-dibromothiophen-2-yl)methylamino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(4,5-dibromothiophen-2-yl)methylamino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 102833620 |
| Molecular Formula | C12H7Br2F2NO2S |
| Molecular Weight | 427.06 g/mol |
| Exact Mass | 424.85 |
| IUPAC Name | 5-[(4,5-dibromothiophen-2-yl)methylamino]-2,4-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(NCc2cc(Br)c(Br)s2)c(F)cc1F |
| InChI | InChI=1S/C12H7Br2F2NO2S/c13-7-1-5(20-11(7)14)4-17-10-2-6(12(18)19)8(15)3-9(10)16/h1-3,17H,4H2,(H,18,19) |
| InChIKey | REKHVYCKSAIIDK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.06 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |