C14H9F4NO2 — CID 106528385
5-[(3,5-difluorophenyl)methylamino]-2,4-difluorobenzoic acid (PubChem CID 106528385) has the molecular formula C14H9F4NO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methylamino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(3,5-difluorophenyl)methylamino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 106528385 |
| Molecular Formula | C14H9F4NO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methylamino]-2,4-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(NCc2cc(F)cc(F)c2)c(F)cc1F |
| InChI | InChI=1S/C14H9F4NO2/c15-8-1-7(2-9(16)3-8)6-19-13-4-10(14(20)21)11(17)5-12(13)18/h1-5,19H,6H2,(H,20,21) |
| InChIKey | VCCAWYHAWBBQHI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |