C14H14F2N2O2 — CID 66415345
5-[(1-ethylpyrrol-3-yl)methylamino]-2,4-difluorobenzoic acid (PubChem CID 66415345) has the molecular formula C14H14F2N2O2 and a molecular weight of 280.27 g/mol. Its IUPAC name is 5-[(1-ethylpyrrol-3-yl)methylamino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(1-ethylpyrrol-3-yl)methylamino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 66415345 |
| Molecular Formula | C14H14F2N2O2 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-[(1-ethylpyrrol-3-yl)methylamino]-2,4-difluorobenzoic acid |
| SMILES | CCn1ccc(CNc2cc(C(=O)O)c(F)cc2F)c1 |
| InChI | InChI=1S/C14H14F2N2O2/c1-2-18-4-3-9(8-18)7-17-13-5-10(14(19)20)11(15)6-12(13)16/h3-6,8,17H,2,7H2,1H3,(H,19,20) |
| InChIKey | ZUZPMYWIOAAPOB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |