C14H13F2NO2S — CID 62346258
5-[(5-ethylthiophen-2-yl)methylamino]-2,4-difluorobenzoic acid (PubChem CID 62346258) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is 5-[(5-ethylthiophen-2-yl)methylamino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(5-ethylthiophen-2-yl)methylamino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 62346258 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 5-[(5-ethylthiophen-2-yl)methylamino]-2,4-difluorobenzoic acid |
| SMILES | CCc1ccc(CNc2cc(C(=O)O)c(F)cc2F)s1 |
| InChI | InChI=1S/C14H13F2NO2S/c1-2-8-3-4-9(20-8)7-17-13-5-10(14(18)19)11(15)6-12(13)16/h3-6,17H,2,7H2,1H3,(H,18,19) |
| InChIKey | HCAUNFGBIUXUGQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |